* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34338075 |
English Synonyms: | UKRORGSYN-BB BBV-34338075 |
MDL Number.: | MFCD16790363 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | Cc1ccc(o1)CN(C)C(C)CNC |
InChi: | InChI=1S/C11H20N2O/c1-9(7-12-3)13(4)8-11-6-5-10(2)14-11/h5-6,9,12H,7-8H2,1-4H3 |
InChiKey: | InChIKey=HQGPDWWZLFJYPH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.