* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34338107 |
English Synonyms: | UKRORGSYN-BB BBV-34338107 |
MDL Number.: | MFCD16790395 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CN(CCCCNC1CC1)Cc2ccsc2 |
InChi: | InChI=1S/C13H22N2S/c1-15(10-12-6-9-16-11-12)8-3-2-7-14-13-4-5-13/h6,9,11,13-14H,2-5,7-8,10H2,1H3 |
InChiKey: | InChIKey=MUDJYLHPMDNPDR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.