* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34338732 |
| English Synonyms: | UKRORGSYN-BB BBV-34338732 |
| MDL Number.: | MFCD16790997 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCCN(CCN(C)C)C(C)CNC |
| InChi: | InChI=1S/C11H27N3/c1-6-7-14(9-8-13(4)5)11(2)10-12-3/h11-12H,6-10H2,1-5H3 |
| InChiKey: | InChIKey=BVKSHVIMWAGUNX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.