* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34338735 |
English Synonyms: | UKRORGSYN-BB BBV-34338735 |
MDL Number.: | MFCD16791000 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCCN(CCN(C)C)C(C)CNC(C)C |
InChi: | InChI=1S/C13H31N3/c1-7-8-16(10-9-15(5)6)13(4)11-14-12(2)3/h12-14H,7-11H2,1-6H3 |
InChiKey: | InChIKey=AAEGUBMBCPQDCV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.