* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-36639159 |
English Synonyms: | UKRORGSYN-BB BBV-36639159 |
MDL Number.: | MFCD16793544 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCNCc1nc(cs1)c2ccccn2 |
InChi: | InChI=1S/C11H13N3S/c1-2-12-7-11-14-10(8-15-11)9-5-3-4-6-13-9/h3-6,8,12H,2,7H2,1H3 |
InChiKey: | InChIKey=QCKAHAPJKPSSRC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.