* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34346902 |
English Synonyms: | UKRORGSYN-BB BBV-34346902 |
MDL Number.: | MFCD16798009 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CC(CNCc1ccco1)N2CCSCC2 |
InChi: | InChI=1S/C12H20N2OS/c1-11(14-4-7-16-8-5-14)9-13-10-12-3-2-6-15-12/h2-3,6,11,13H,4-5,7-10H2,1H3 |
InChiKey: | InChIKey=ASMWYOUEXKXKRG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.