* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34347518 |
English Synonyms: | UKRORGSYN-BB BBV-34347518 |
MDL Number.: | MFCD16798624 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CC(CNCCCOC)N(C)CC1CC1 |
InChi: | InChI=1S/C12H26N2O/c1-11(9-13-7-4-8-15-3)14(2)10-12-5-6-12/h11-13H,4-10H2,1-3H3 |
InChiKey: | InChIKey=IGPAZLDKAVSHFS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.