* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34347522 |
English Synonyms: | UKRORGSYN-BB BBV-34347522 |
MDL Number.: | MFCD16798628 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CC(CNCc1ccco1)N(C)CC2CC2 |
InChi: | InChI=1S/C13H22N2O/c1-11(15(2)10-12-5-6-12)8-14-9-13-4-3-7-16-13/h3-4,7,11-12,14H,5-6,8-10H2,1-2H3 |
InChiKey: | InChIKey=HQSUVSGISXHDBF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.