* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34348176 |
English Synonyms: | UKRORGSYN-BB BBV-34348176 |
MDL Number.: | MFCD16799244 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CC(CNC1CCCC1)n2cccn2 |
InChi: | InChI=1S/C11H19N3/c1-10(14-8-4-7-13-14)9-12-11-5-2-3-6-11/h4,7-8,10-12H,2-3,5-6,9H2,1H3 |
InChiKey: | InChIKey=VKWJOBZHYVZRHB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.