* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34348184 |
| English Synonyms: | UKRORGSYN-BB BBV-34348184 |
| MDL Number.: | MFCD16799252 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | c1ccc(c(c1)NCCn2cncn2)Br |
| InChi: | InChI=1S/C10H11BrN4/c11-9-3-1-2-4-10(9)13-5-6-15-8-12-7-14-15/h1-4,7-8,13H,5-6H2 |
| InChiKey: | InChIKey=AZGXQZALZYPUAW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.