* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34348215 |
English Synonyms: | UKRORGSYN-BB BBV-34348215 |
MDL Number.: | MFCD16799283 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1cc(cc(c1)F)NCCn2cncn2 |
InChi: | InChI=1S/C10H11FN4/c11-9-2-1-3-10(6-9)13-4-5-15-8-12-7-14-15/h1-3,6-8,13H,4-5H2 |
InChiKey: | InChIKey=LPDPZVBOULCPLN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.