* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34348895 |
English Synonyms: | UKRORGSYN-BB BBV-34348895 |
MDL Number.: | MFCD16799955 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CC(CNCC#C)n1c2ccccc2cn1 |
InChi: | InChI=1S/C13H15N3/c1-3-8-14-9-11(2)16-13-7-5-4-6-12(13)10-15-16/h1,4-7,10-11,14H,8-9H2,2H3 |
InChiKey: | InChIKey=PPPQDKGHWINRFD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.