* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34348901 |
English Synonyms: | UKRORGSYN-BB BBV-34348901 |
MDL Number.: | MFCD16799961 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | C=CCNCCn1ccc2c1cc(cc2)Br |
InChi: | InChI=1S/C13H15BrN2/c1-2-6-15-7-9-16-8-5-11-3-4-12(14)10-13(11)16/h2-5,8,10,15H,1,6-7,9H2 |
InChiKey: | InChIKey=CHAXKKIEBYUTAO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.