* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34348904 |
| English Synonyms: | UKRORGSYN-BB BBV-34348904 |
| MDL Number.: | MFCD16799962 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CNCCCn1ccc2c1cc(cc2)Br |
| InChi: | InChI=1S/C12H15BrN2/c1-14-6-2-7-15-8-5-10-3-4-11(13)9-12(10)15/h3-5,8-9,14H,2,6-7H2,1H3 |
| InChiKey: | InChIKey=ZJIWEUMLANEYTA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.