* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34348912 |
English Synonyms: | UKRORGSYN-BB BBV-34348912 |
MDL Number.: | MFCD16799970 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CNCCCCn1ccc2c1cc(cc2)Br |
InChi: | InChI=1S/C13H17BrN2/c1-15-7-2-3-8-16-9-6-11-4-5-12(14)10-13(11)16/h4-6,9-10,15H,2-3,7-8H2,1H3 |
InChiKey: | InChIKey=KRHYUZVGIDNOML-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.