* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34349034 |
English Synonyms: | UKRORGSYN-BB BBV-34349034 |
MDL Number.: | MFCD16800092 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CC(CNCC#C)n1cc(cn1)Br |
InChi: | InChI=1S/C9H12BrN3/c1-3-4-11-5-8(2)13-7-9(10)6-12-13/h1,6-8,11H,4-5H2,2H3 |
InChiKey: | InChIKey=JLWRYDCQTGHSQL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.