* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34349059 |
English Synonyms: | UKRORGSYN-BB BBV-34349059 |
MDL Number.: | MFCD16800117 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1cscc1CCNCCn2cc(cn2)Br |
InChi: | InChI=1S/C11H14BrN3S/c12-11-7-14-15(8-11)5-4-13-3-1-10-2-6-16-9-10/h2,6-9,13H,1,3-5H2 |
InChiKey: | InChIKey=PNVZKLBUEVWQJT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.