* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34349111 |
English Synonyms: | UKRORGSYN-BB BBV-34349111 |
MDL Number.: | MFCD16800169 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CCNCCn1nc(nn1)c2ccco2 |
InChi: | InChI=1S/C9H13N5O/c1-2-10-5-6-14-12-9(11-13-14)8-4-3-7-15-8/h3-4,7,10H,2,5-6H2,1H3 |
InChiKey: | InChIKey=LHHGVGUTEVCUQU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.