* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34349156 |
English Synonyms: | UKRORGSYN-BB BBV-34349156 |
MDL Number.: | MFCD16800214 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCc1nccn1C(C)CNCCOC |
InChi: | InChI=1S/C11H21N3O/c1-4-11-13-5-7-14(11)10(2)9-12-6-8-15-3/h5,7,10,12H,4,6,8-9H2,1-3H3 |
InChiKey: | InChIKey=AZYCGPCWCNRXQH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.