* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34349160 |
| English Synonyms: | UKRORGSYN-BB BBV-34349160 |
| MDL Number.: | MFCD16800218 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCc1nccn1C(C)CNC(CC)CC |
| InChi: | InChI=1S/C13H25N3/c1-5-12(6-2)15-10-11(4)16-9-8-14-13(16)7-3/h8-9,11-12,15H,5-7,10H2,1-4H3 |
| InChiKey: | InChIKey=KHTXLCKUGZVYNL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.