* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34349162 |
| English Synonyms: | UKRORGSYN-BB BBV-34349162 |
| MDL Number.: | MFCD16800220 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCCCNCC(C)n1ccnc1CC |
| InChi: | InChI=1S/C12H23N3/c1-4-6-7-13-10-11(3)15-9-8-14-12(15)5-2/h8-9,11,13H,4-7,10H2,1-3H3 |
| InChiKey: | InChIKey=NPXGMENANPAVPC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.