* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34349163 |
English Synonyms: | UKRORGSYN-BB BBV-34349163 |
MDL Number.: | MFCD16800221 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCc1nccn1C(C)CNCCCOC |
InChi: | InChI=1S/C12H23N3O/c1-4-12-14-7-8-15(12)11(2)10-13-6-5-9-16-3/h7-8,11,13H,4-6,9-10H2,1-3H3 |
InChiKey: | InChIKey=PYHSFJJWPLPIAH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.