* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34349165 |
English Synonyms: | UKRORGSYN-BB BBV-34349165 |
MDL Number.: | MFCD16800223 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCCC(C)NCC(C)n1ccnc1CC |
InChi: | InChI=1S/C13H25N3/c1-5-7-11(3)15-10-12(4)16-9-8-14-13(16)6-2/h8-9,11-12,15H,5-7,10H2,1-4H3 |
InChiKey: | InChIKey=IYZIMJMTIXNXEE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.