* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34349166 |
English Synonyms: | UKRORGSYN-BB BBV-34349166 |
MDL Number.: | MFCD16800224 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCc1nccn1C(C)CNCC#C |
InChi: | InChI=1S/C11H17N3/c1-4-6-12-9-10(3)14-8-7-13-11(14)5-2/h1,7-8,10,12H,5-6,9H2,2-3H3 |
InChiKey: | InChIKey=RNCSOONDLATASH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.