* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34349170 |
| English Synonyms: | UKRORGSYN-BB BBV-34349170 |
| MDL Number.: | MFCD16800228 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCc1nccn1CCNCCCOC |
| InChi: | InChI=1S/C11H21N3O/c1-3-11-13-7-9-14(11)8-6-12-5-4-10-15-2/h7,9,12H,3-6,8,10H2,1-2H3 |
| InChiKey: | InChIKey=FFRMXMSITJIKDZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.