* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34349174 |
| English Synonyms: | UKRORGSYN-BB BBV-34349174 |
| MDL Number.: | MFCD16800232 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCc1nccn1CCNCC2CCCC2 |
| InChi: | InChI=1S/C13H23N3/c1-2-13-15-8-10-16(13)9-7-14-11-12-5-3-4-6-12/h8,10,12,14H,2-7,9,11H2,1H3 |
| InChiKey: | InChIKey=CMQYBVMGDPRWEV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.