* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34349327 |
English Synonyms: | UKRORGSYN-BB BBV-34349327 |
MDL Number.: | MFCD16800384 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CC(c1cccs1)NCCOCCCOC |
InChi: | InChI=1S/C12H21NO2S/c1-11(12-5-3-10-16-12)13-6-9-15-8-4-7-14-2/h3,5,10-11,13H,4,6-9H2,1-2H3 |
InChiKey: | InChIKey=ADDNEHZFHFLBCK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.