* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | UKRORGSYN-BB BBV-34349378 |
English Synonyms: | UKRORGSYN-BB BBV-34349378 |
MDL Number.: | MFCD16800435 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1cocc1CNCCOC2CCCCC2 |
InChi: | InChI=1S/C13H21NO2/c1-2-4-13(5-3-1)16-9-7-14-10-12-6-8-15-11-12/h6,8,11,13-14H,1-5,7,9-10H2 |
InChiKey: | InChIKey=OPPTZMORYKOWCB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.