* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34349887 |
| English Synonyms: | UKRORGSYN-BB BBV-34349887 |
| MDL Number.: | MFCD16800932 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CC(C)COCCNC(C)c1cccs1 |
| InChi: | InChI=1S/C12H21NOS/c1-10(2)9-14-7-6-13-11(3)12-5-4-8-15-12/h4-5,8,10-11,13H,6-7,9H2,1-3H3 |
| InChiKey: | InChIKey=REGDVOWDOYRMLS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.