* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34350458 |
| English Synonyms: | UKRORGSYN-BB BBV-34350458 |
| MDL Number.: | MFCD16801468 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CC(C)CCCOCCNCc1cccs1 |
| InChi: | InChI=1S/C13H23NOS/c1-12(2)5-3-8-15-9-7-14-11-13-6-4-10-16-13/h4,6,10,12,14H,3,5,7-9,11H2,1-2H3 |
| InChiKey: | InChIKey=QQTKMGMPSDRDBD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.