* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34351362 |
English Synonyms: | UKRORGSYN-BB BBV-34351362 |
MDL Number.: | MFCD16802346 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCCCCOCCNCc1cc(cs1)Br |
InChi: | InChI=1S/C12H20BrNOS/c1-2-3-4-6-15-7-5-14-9-12-8-11(13)10-16-12/h8,10,14H,2-7,9H2,1H3 |
InChiKey: | InChIKey=ZXVVPJXMFRMULJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.