* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34351761 |
English Synonyms: | UKRORGSYN-BB BBV-34351761 |
MDL Number.: | MFCD16802738 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1cc(cnc1)OCCNCc2ccoc2 |
InChi: | InChI=1S/C12H14N2O2/c1-2-12(9-13-4-1)16-7-5-14-8-11-3-6-15-10-11/h1-4,6,9-10,14H,5,7-8H2 |
InChiKey: | InChIKey=KYMXDOYIYYEJOD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.