* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34351860 |
English Synonyms: | UKRORGSYN-BB BBV-34351860 |
MDL Number.: | MFCD16802837 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1cc(sc1)CNCCOC2CCOCC2 |
InChi: | InChI=1S/C12H19NO2S/c1-2-12(16-9-1)10-13-5-8-15-11-3-6-14-7-4-11/h1-2,9,11,13H,3-8,10H2 |
InChiKey: | InChIKey=XUBSVKCSFNIYOY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.