* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34351987 |
| English Synonyms: | UKRORGSYN-BB BBV-34351987 |
| MDL Number.: | MFCD16802964 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | c1cocc1CNCCOCC2CCOC2 |
| InChi: | InChI=1S/C12H19NO3/c1-4-14-8-11(1)7-13-3-6-16-10-12-2-5-15-9-12/h1,4,8,12-13H,2-3,5-7,9-10H2 |
| InChiKey: | InChIKey=LTYSMQFBRIIUEO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.