* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34352463 |
English Synonyms: | UKRORGSYN-BB BBV-34352463 |
MDL Number.: | MFCD16803439 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1cocc1CNCCSc2nncs2 |
InChi: | InChI=1S/C9H11N3OS2/c1-3-13-6-8(1)5-10-2-4-14-9-12-11-7-15-9/h1,3,6-7,10H,2,4-5H2 |
InChiKey: | InChIKey=WOCVAOLUVLNTIX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.