* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34352511 |
English Synonyms: | UKRORGSYN-BB BBV-34352511 |
MDL Number.: | MFCD16803487 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCCCNCCSc1nc(cs1)C |
InChi: | InChI=1S/C10H18N2S2/c1-3-4-5-11-6-7-13-10-12-9(2)8-14-10/h8,11H,3-7H2,1-2H3 |
InChiKey: | InChIKey=JBZQJBPEWQMAKW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.