* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34352524 |
English Synonyms: | UKRORGSYN-BB BBV-34352524 |
MDL Number.: | MFCD16803500 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCCCNCC(C)Sc1nc(cs1)C |
InChi: | InChI=1S/C11H20N2S2/c1-4-5-6-12-7-10(3)15-11-13-9(2)8-14-11/h8,10,12H,4-7H2,1-3H3 |
InChiKey: | InChIKey=DVCICSVGXCEZJT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.