* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34352551 |
English Synonyms: | UKRORGSYN-BB BBV-34352551 |
MDL Number.: | MFCD16803527 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | Cc1csc(n1)SC(C)CNCC(F)(F)F |
InChi: | InChI=1S/C9H13F3N2S2/c1-6-4-15-8(14-6)16-7(2)3-13-5-9(10,11)12/h4,7,13H,3,5H2,1-2H3 |
InChiKey: | InChIKey=MRRFUKVKFQCUSR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.