* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | UKRORGSYN-BB BBV-34352565 |
English Synonyms: | UKRORGSYN-BB BBV-34352565 |
MDL Number.: | MFCD16803541 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | Cc1csc(n1)SCCNCCCN(C)C |
InChi: | InChI=1S/C11H21N3S2/c1-10-9-16-11(13-10)15-8-6-12-5-4-7-14(2)3/h9,12H,4-8H2,1-3H3 |
InChiKey: | InChIKey=VPCLAVXXFXQAKO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.