* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | UKRORGSYN-BB BBV-34352575 |
English Synonyms: | UKRORGSYN-BB BBV-34352575 |
MDL Number.: | MFCD16803551 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | C=CCNCCSc1nc2ccccc2s1 |
InChi: | InChI=1S/C12H14N2S2/c1-2-7-13-8-9-15-12-14-10-5-3-4-6-11(10)16-12/h2-6,13H,1,7-9H2 |
InChiKey: | InChIKey=UDKSPOUCPCXHQY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.