* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | UKRORGSYN-BB BBV-34352585 |
English Synonyms: | UKRORGSYN-BB BBV-34352585 |
MDL Number.: | MFCD16803561 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CC(C)CNCC(C)Sc1nccn1C |
InChi: | InChI=1S/C11H21N3S/c1-9(2)7-12-8-10(3)15-11-13-5-6-14(11)4/h5-6,9-10,12H,7-8H2,1-4H3 |
InChiKey: | InChIKey=PFBYKPKHLGGSOH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.