* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34352596 |
English Synonyms: | UKRORGSYN-BB BBV-34352596 |
MDL Number.: | MFCD16803572 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCCNCCCCSc1nccn1C |
InChi: | InChI=1S/C11H21N3S/c1-3-6-12-7-4-5-10-15-11-13-8-9-14(11)2/h8-9,12H,3-7,10H2,1-2H3 |
InChiKey: | InChIKey=PDWVVLGXEMHGRW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.