* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34352622 |
| English Synonyms: | UKRORGSYN-BB BBV-34352622 |
| MDL Number.: | MFCD16803598 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | Cn1ccnc1SCCNCCCN(C)C |
| InChi: | InChI=1S/C11H22N4S/c1-14(2)8-4-5-12-7-10-16-11-13-6-9-15(11)3/h6,9,12H,4-5,7-8,10H2,1-3H3 |
| InChiKey: | InChIKey=LROVBDQWLZCDNP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.