* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34352636 |
| English Synonyms: | UKRORGSYN-BB BBV-34352636 |
| MDL Number.: | MFCD16803611 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CC(C)CNCC(C)Sc1nnnn1C |
| InChi: | InChI=1S/C9H19N5S/c1-7(2)5-10-6-8(3)15-9-11-12-13-14(9)4/h7-8,10H,5-6H2,1-4H3 |
| InChiKey: | InChIKey=FATBASYFCRHOKJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.