* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34352674 |
English Synonyms: | UKRORGSYN-BB BBV-34352674 |
MDL Number.: | MFCD16803649 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CCOCCCNCCSc1nnnn1C |
InChi: | InChI=1S/C9H19N5OS/c1-3-15-7-4-5-10-6-8-16-9-11-12-13-14(9)2/h10H,3-8H2,1-2H3 |
InChiKey: | InChIKey=HPBOVXWXTJGOPW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.