* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34352686 |
English Synonyms: | UKRORGSYN-BB BBV-34352686 |
MDL Number.: | MFCD16803661 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | Cn1c(nnn1)SCCNC2CCCC2 |
InChi: | InChI=1S/C9H17N5S/c1-14-9(11-12-13-14)15-7-6-10-8-4-2-3-5-8/h8,10H,2-7H2,1H3 |
InChiKey: | InChIKey=SZKOHJLWVMLRQO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.