* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34352702 |
English Synonyms: | UKRORGSYN-BB BBV-34352702 |
MDL Number.: | MFCD16803676 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | c1nc([nH]n1)SCCNCC2CCCO2 |
InChi: | InChI=1S/C9H16N4OS/c1-2-8(14-4-1)6-10-3-5-15-9-11-7-12-13-9/h7-8,10H,1-6H2,(H,11,12,13) |
InChiKey: | InChIKey=UIDMDHJLIDAUJL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.