* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34353291 |
| English Synonyms: | UKRORGSYN-BB BBV-34353291 |
| MDL Number.: | MFCD16804260 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | CCC(C)SCCNCc1cccs1 |
| InChi: | InChI=1S/C11H19NS2/c1-3-10(2)13-8-6-12-9-11-5-4-7-14-11/h4-5,7,10,12H,3,6,8-9H2,1-2H3 |
| InChiKey: | InChIKey=ONAUDFLUPRMCNY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.