* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34353344 |
| English Synonyms: | UKRORGSYN-BB BBV-34353344 |
| MDL Number.: | MFCD16804313 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | CCC(C)SCCNCc1c(ccs1)C |
| InChi: | InChI=1S/C12H21NS2/c1-4-11(3)14-8-6-13-9-12-10(2)5-7-15-12/h5,7,11,13H,4,6,8-9H2,1-3H3 |
| InChiKey: | InChIKey=AGCPIQWBQDBBTM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.