* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34353349 |
English Synonyms: | UKRORGSYN-BB BBV-34353349 |
MDL Number.: | MFCD16804318 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CCC(C)SCCNCc1ccc(s1)C |
InChi: | InChI=1S/C12H21NS2/c1-4-10(2)14-8-7-13-9-12-6-5-11(3)15-12/h5-6,10,13H,4,7-9H2,1-3H3 |
InChiKey: | InChIKey=RZCAAYOCLPEYLT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.